CAS 2092422-76-7 is the registry number for Methyl 2-bromo-4-chloro-1-methyl-1H-imidazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-bromo-5-chloro-3-methylimidazole-4-carboxylate (CAS 2092422-76-7) is a chemical compound with the molecular formula C6H6BrClN2O2 and a molecular weight of 253.48 g/mol. IUPAC name: methyl 2-bromo-5-chloro-3-methylimidazole-4-carboxylate. InChIKey: AJHWQYIKHXWBFL-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN2O2 |
|---|---|
| Molecular weight | 253.48 g/mol |
| IUPAC name | methyl 2-bromo-5-chloro-3-methylimidazole-4-carboxylate |
| InChIKey | AJHWQYIKHXWBFL-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=C1Br)Cl)C(=O)OC |
Computed by PubChem (NCBI)