Products 2893877-53-5
CAS 2893877-53-5 is the registry number for Methyl 5-bromo-4-chloro-1-methyl-1H-imidazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-4-chloro-1-methylimidazole-2-carboxylate (CAS 2893877-53-5) is a chemical compound with the molecular formula C6H6BrClN2O2 and a molecular weight of 253.48 g/mol. IUPAC name: methyl 5-bromo-4-chloro-1-methylimidazole-2-carboxylate. InChIKey: IDZGIEAAJMTCPU-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN2O2 |
|---|---|
| Molecular weight | 253.48 g/mol |
| IUPAC name | methyl 5-bromo-4-chloro-1-methylimidazole-2-carboxylate |
| InChIKey | IDZGIEAAJMTCPU-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=C1C(=O)OC)Cl)Br |
Computed by PubChem (NCBI)