CAS 2225146-31-4 appears in our catalog under these names: 4-Amino-5-bromonicotinic acid hydrochloride, 98%, 4-amino-5-bromopyridine-3-carboxylic acid hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-amino-5-bromopyridine-3-carboxylic acid;hydrochloride (CAS 2225146-31-4) is a chemical compound with the molecular formula C6H6BrClN2O2 and a molecular weight of 253.48 g/mol. IUPAC name: 4-amino-5-bromopyridine-3-carboxylic acid;hydrochloride. InChIKey: JHXLFMRCXUPFPX-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN2O2 |
|---|---|
| Molecular weight | 253.48 g/mol |
| IUPAC name | 4-amino-5-bromopyridine-3-carboxylic acid;hydrochloride |
| InChIKey | JHXLFMRCXUPFPX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)N)C(=O)O.Cl |
Computed by PubChem (NCBI)