Products 209256-64-4
CAS 209256-64-4 appears in our catalog under these names: Chroman-5-carboxylic acid, 95%, Chroman-5-carboxylic acid, Chroman-5-carboxylic acid 95%, Chroman-5-Carboxylic Acid, 95%, 95%, CHROMAN-5-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
3,4-dihydro-2H-chromene-5-carboxylic acid (CAS 209256-64-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3,4-dihydro-2H-chromene-5-carboxylic acid. InChIKey: GOHXEALVTBUNGX-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromene-5-carboxylic acid |
| InChIKey | GOHXEALVTBUNGX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2OC1)C(=O)O |
Computed by PubChem (NCBI)