CAS 2092644-89-6 is the registry number for 2-(4-Bromo-2-chlorophenyl)acetamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-bromo-2-chlorophenyl)acetamide (CAS 2092644-89-6) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)acetamide. InChIKey: FNSPQAMSQKRANF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)acetamide |
| InChIKey | FNSPQAMSQKRANF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)CC(=O)N |
Computed by PubChem (NCBI)