CAS 2092929-96-7 is the registry number for 3,5-Dichloro-pyrrolo[2,3-c]pyridine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl 3,5-dichloropyrrolo[2,3-c]pyridine-1-carboxylate (CAS 2092929-96-7) is a chemical compound with the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.14 g/mol. IUPAC name: tert-butyl 3,5-dichloropyrrolo[2,3-c]pyridine-1-carboxylate. InChIKey: HAPXTAZMGJBHRH-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O2 |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | tert-butyl 3,5-dichloropyrrolo[2,3-c]pyridine-1-carboxylate |
| InChIKey | HAPXTAZMGJBHRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC(=NC=C21)Cl)Cl |
Computed by PubChem (NCBI)