Products 2940961-11-3
CAS 2940961-11-3 is the registry number for tert-butyl 4,6-dichloropyrrolo[3,2-c]pyridine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4,6-dichloropyrrolo[3,2-c]pyridine-1-carboxylate (CAS 2940961-11-3) is a chemical compound with the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.14 g/mol. IUPAC name: tert-butyl 4,6-dichloropyrrolo[3,2-c]pyridine-1-carboxylate. InChIKey: GNQZZUKNTDGOSM-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O2 |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | tert-butyl 4,6-dichloropyrrolo[3,2-c]pyridine-1-carboxylate |
| InChIKey | GNQZZUKNTDGOSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(N=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)