Products 851399-62-7
CAS 851399-62-7 is the registry number for 4-(2-(2,6-Dichlorophenyl)acetyl)piperazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(2,6-dichlorophenyl)acetyl]piperazin-2-one (CAS 851399-62-7) is a chemical compound with the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.14 g/mol. IUPAC name: 4-[2-(2,6-dichlorophenyl)acetyl]piperazin-2-one. InChIKey: FAZMWFHOCUAYSK-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O2 |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | 4-[2-(2,6-dichlorophenyl)acetyl]piperazin-2-one |
| InChIKey | FAZMWFHOCUAYSK-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)C(=O)CC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)