Products 20939-82-6
CAS 20939-82-6 appears in our catalog under these names: 2-[(2,2,2-trifluoroethyl)amino]benzoic acid, 95%, 2-((2,2,2-Trifluoroethyl)amino)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
2-(2,2,2-trifluoroethylamino)benzoic acid (CAS 20939-82-6) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-(2,2,2-trifluoroethylamino)benzoic acid. InChIKey: TYQJCIIATXTPRQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethylamino)benzoic acid |
| InChIKey | TYQJCIIATXTPRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NCC(F)(F)F |
Computed by PubChem (NCBI)