Products 2094-03-3
CAS 2094-03-3 is the registry number for 2-(3-Fluorophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-fluorophenyl)benzoic acid (CAS 2094-03-3) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 2-(3-fluorophenyl)benzoic acid. InChIKey: GEZNPQHOTCPFEL-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-(3-fluorophenyl)benzoic acid |
| InChIKey | GEZNPQHOTCPFEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3-fluorophenyl)benzoic Acid, 3'-Fluoro-[1,1'-biphenyl]-2-carboxylic acid, 3'-Fluoro-biphenyl-2-carboxylic acid, 2-biphenyl-3'-fluoro-carboxylic acid, 3'-fluorobiphenyl-2-carboxylic acid, [1,1'-Biphenyl]-2-carboxylic acid, 3'-fluoro-, 3'-fluoro[1,1'-biphenyl]-2-carboxylic acid, 3'-Fluoro-[1,1'-biphenyl]-2-carboxylicacid, GEZNPQHOTCPFEL-UHFFFAOYSA-N, 3'-Fluoro-2-biphenylcarboxylic acid