CAS 2095071-24-0 is the registry number for 7-Bromo-2,2-dimethyl-2,3,4,5-tetrahydrobenzo(f)(1,4)oxazepine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride (CAS 2095071-24-0) is a chemical compound with the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. IUPAC name: 7-bromo-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride. InChIKey: KCTITKHKIGQKBU-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClNO |
|---|---|
| Molecular weight | 292.60 g/mol |
| IUPAC name | 7-bromo-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine;hydrochloride |
| InChIKey | KCTITKHKIGQKBU-UHFFFAOYSA-N |
| SMILES | CC1(CNCC2=C(O1)C=CC(=C2)Br)C.Cl |
Computed by PubChem (NCBI)