CAS 213480-97-8 appears in our catalog under these names: 4-(4-Bromophenyl)Piperidin-4-Ol Hydrochloride, 97%, 97%, 4-(4'-Bromophenyl)-4-hydroxypiperidine hydrochloride, 95%, 4-(4-Bromophenyl)piperidin-4-ol hydrochloride, 98%, 4-Piperidinol, 4-(4-bromophenyl)-, hydrochloride (1:1), 4-(4-Bromophenyl)piperidin-4-ol hydrochloride 98%. Offered by: Chemat, Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(4-bromophenyl)piperidin-4-ol;hydrochloride (CAS 213480-97-8) is a chemical compound with the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. IUPAC name: 4-(4-bromophenyl)piperidin-4-ol;hydrochloride. InChIKey: DBZKQRKEZICYCJ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClNO |
|---|---|
| Molecular weight | 292.60 g/mol |
| IUPAC name | 4-(4-bromophenyl)piperidin-4-ol;hydrochloride |
| InChIKey | DBZKQRKEZICYCJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=C(C=C2)Br)O.Cl |
Computed by PubChem (NCBI)