Products 2504203-24-9
CAS 2504203-24-9 is the registry number for 1-(3-Bromo-5-methyl-phenoxymethyl)-cyclopropylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-[(3-bromo-5-methylphenoxy)methyl]cyclopropan-1-amine;hydrochloride (CAS 2504203-24-9) is a chemical compound with the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. IUPAC name: 1-[(3-bromo-5-methylphenoxy)methyl]cyclopropan-1-amine;hydrochloride. InChIKey: DXWRKMPJONSGPM-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClNO |
|---|---|
| Molecular weight | 292.60 g/mol |
| IUPAC name | 1-[(3-bromo-5-methylphenoxy)methyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | DXWRKMPJONSGPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)OCC2(CC2)N.Cl |
Computed by PubChem (NCBI)