CAS 209531-11-3 is the registry number for 5-tert-Butyl-2-oxazolecarboxylic Acid. Offered by: TRC. Available pack sizes: 1g.
5-tert-butyl-1,3-oxazole-2-carboxylic acid (CAS 209531-11-3) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-tert-butyl-1,3-oxazole-2-carboxylic acid. InChIKey: VBNWSGXUJZAXOY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-tert-butyl-1,3-oxazole-2-carboxylic acid |
| InChIKey | VBNWSGXUJZAXOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=C(O1)C(=O)O |
Computed by PubChem (NCBI)