Products 2095396-11-3
CAS 2095396-11-3 is the registry number for rac-Methyl (1R,2R)-1-cyano-2-methanesulfonylcyclopropane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Trans-methyl (1R,2R)-1-cyano-2-methylsulfonylcyclopropane-1-carboxylate (CAS 2095396-11-3) is a chemical compound with the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. IUPAC name: trans-methyl (1R,2R)-1-cyano-2-methylsulfonylcyclopropane-1-carboxylate. InChIKey: JYPXFUUFWZWJHM-VDTYLAMSSA-N.
| Molecular formula | C7H9NO4S |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | trans-methyl (1R,2R)-1-cyano-2-methylsulfonylcyclopropane-1-carboxylate |
| InChIKey | JYPXFUUFWZWJHM-VDTYLAMSSA-N |
| SMILES | COC(=O)[C@@]1(C[C@H]1S(=O)(=O)C)C#N |
Computed by PubChem (NCBI)