Products 2095409-65-5
CAS 2095409-65-5 is the registry number for 2-(2,4-Dimethyl-1H-imidazol-5-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,5-dimethyl-1H-imidazol-4-yl)acetic acid;hydrochloride (CAS 2095409-65-5) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-(2,5-dimethyl-1H-imidazol-4-yl)acetic acid;hydrochloride. InChIKey: FKJUFSXSGFLHGM-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 2-(2,5-dimethyl-1H-imidazol-4-yl)acetic acid;hydrochloride |
| InChIKey | FKJUFSXSGFLHGM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C)CC(=O)O.Cl |
Computed by PubChem (NCBI)