CAS 2095409-72-4 is the registry number for Potassium 1-(2-methoxyethyl)-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Potassium 1-(2-methoxyethyl)pyrazole-4-carboxylate (CAS 2095409-72-4) is a chemical compound with the molecular formula C7H9KN2O3 and a molecular weight of 208.26 g/mol. IUPAC name: potassium 1-(2-methoxyethyl)pyrazole-4-carboxylate. InChIKey: NJIYYKKBIGBYOT-UHFFFAOYSA-M.
| Molecular formula | C7H9KN2O3 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | potassium 1-(2-methoxyethyl)pyrazole-4-carboxylate |
| InChIKey | NJIYYKKBIGBYOT-UHFFFAOYSA-M |
| SMILES | COCCN1C=C(C=N1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)