Products 2247616-83-5
CAS 2247616-83-5 is the registry number for Potassium 5-(tert-butyl)-1,2,4-oxadiazole-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Potassium 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate (CAS 2247616-83-5) is a chemical compound with the molecular formula C7H9KN2O3 and a molecular weight of 208.26 g/mol. IUPAC name: potassium 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate. InChIKey: GGVQMZOBXOVQPR-UHFFFAOYSA-M.
| Molecular formula | C7H9KN2O3 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | potassium 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate |
| InChIKey | GGVQMZOBXOVQPR-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=NC(=NO1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)