CAS 2247616-84-6 is the registry number for Potassium 5-(tert-butyl)-1,3,4-oxadiazole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate (CAS 2247616-84-6) is a chemical compound with the molecular formula C7H9KN2O3 and a molecular weight of 208.26 g/mol. IUPAC name: potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate. InChIKey: PEBNVISHTWMUMV-UHFFFAOYSA-M.
| Molecular formula | C7H9KN2O3 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | PEBNVISHTWMUMV-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=NN=C(O1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)