Products 2095409-87-1

CAS 2095409-87-1 is the registry number for Methyl 3-amino-2,2-difluoro-4-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride (CAS 2095409-87-1) is a chemical compound with the molecular formula C7H14ClF2NO2 and a molecular weight of 217.64 g/mol. IUPAC name: methyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride. InChIKey: XVAYNECJTPOYGG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClF2NO2
Molecular weight217.64 g/mol
IUPAC namemethyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride
InChIKeyXVAYNECJTPOYGG-UHFFFAOYSA-N
SMILESCC(C)C(C(C(=O)OC)(F)F)N.Cl

Computed by PubChem (NCBI)