CAS 2095409-87-1 is the registry number for Methyl 3-amino-2,2-difluoro-4-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride (CAS 2095409-87-1) is a chemical compound with the molecular formula C7H14ClF2NO2 and a molecular weight of 217.64 g/mol. IUPAC name: methyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride. InChIKey: XVAYNECJTPOYGG-UHFFFAOYSA-N.
| Molecular formula | C7H14ClF2NO2 |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | methyl 3-amino-2,2-difluoro-4-methylpentanoate;hydrochloride |
| InChIKey | XVAYNECJTPOYGG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C(=O)OC)(F)F)N.Cl |
Computed by PubChem (NCBI)