CAS 2639392-70-2 appears in our catalog under these names: NV-5138 hydrochloride, 98%, NV–5138 hydrochloride, (2S)-2-amino-5,5-difluoro-4,4-dimethylpentanoic acid hydrochloride, 98.0%, 98.0%, Mefluleucine (hydrochloride), 98.0%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 100mg, 5mg, 50mg, 10mM/1mL, 5 mg, 10 mg.
(2S)-2-amino-5,5-difluoro-4,4-dimethylpentanoic acid;hydrochloride (CAS 2639392-70-2) is a chemical compound with the molecular formula C7H14ClF2NO2 and a molecular weight of 217.64 g/mol. IUPAC name: (2S)-2-amino-5,5-difluoro-4,4-dimethylpentanoic acid;hydrochloride. InChIKey: SIUFCONWYBJSOP-WCCKRBBISA-N.
| Molecular formula | C7H14ClF2NO2 |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | (2S)-2-amino-5,5-difluoro-4,4-dimethylpentanoic acid;hydrochloride |
| InChIKey | SIUFCONWYBJSOP-WCCKRBBISA-N |
| SMILES | CC(C)(C[C@@H](C(=O)O)N)C(F)F.Cl |
Computed by PubChem (NCBI)