CAS 2378501-14-3 is the registry number for 3-(Dimethylamino)-4,4-difluoro-3-methylbutanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(dimethylamino)-4,4-difluoro-3-methylbutanoic acid;hydrochloride (CAS 2378501-14-3) is a chemical compound with the molecular formula C7H14ClF2NO2 and a molecular weight of 217.64 g/mol. IUPAC name: 3-(dimethylamino)-4,4-difluoro-3-methylbutanoic acid;hydrochloride. InChIKey: SLJBBAGRUSLKIL-UHFFFAOYSA-N.
| Molecular formula | C7H14ClF2NO2 |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | 3-(dimethylamino)-4,4-difluoro-3-methylbutanoic acid;hydrochloride |
| InChIKey | SLJBBAGRUSLKIL-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)(C(F)F)N(C)C.Cl |
Computed by PubChem (NCBI)