Products 2095410-11-8

CAS 2095410-11-8 is the registry number for 2-(3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)oxan-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)oxan-3-yl]acetic acid (CAS 2095410-11-8) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)oxan-3-yl]acetic acid. InChIKey: OJNUTKRUPRODJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23NO5
Molecular weight381.4 g/mol
IUPAC name2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)oxan-3-yl]acetic acid
InChIKeyOJNUTKRUPRODJZ-UHFFFAOYSA-N
SMILESC1CC(COC1)(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)