CAS 2095410-73-2 is the registry number for 3-Oxo-3,4-dihydro-2H-1,4-benzoxazine-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-oxo-4H-1,4-benzoxazine-5-sulfonamide (CAS 2095410-73-2) is a chemical compound with the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-5-sulfonamide. InChIKey: ZUNREQTZAHABTR-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4S |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-5-sulfonamide |
| InChIKey | ZUNREQTZAHABTR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)