CAS 2095516-66-6 is the registry number for (S)-3-Amino-8-bromo-5-methyl-2,3-dihydrobenzo[b][1,4]oxazepin-4(5H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-amino-8-bromo-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride (CAS 2095516-66-6) is a chemical compound with the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. IUPAC name: (3S)-3-amino-8-bromo-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride. InChIKey: GOYCTTLXTUYDQA-FJXQXJEOSA-N.
| Molecular formula | C10H12BrClN2O2 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | (3S)-3-amino-8-bromo-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride |
| InChIKey | GOYCTTLXTUYDQA-FJXQXJEOSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)OC[C@@H](C1=O)N.Cl |
Computed by PubChem (NCBI)