Products 2383939-43-1
CAS 2383939-43-1 is the registry number for tert-Butyl (4-bromo-6-chloropyridin-3-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl N-(4-bromo-6-chloro-3-pyridinyl)carbamate (CAS 2383939-43-1) is a chemical compound with the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. IUPAC name: tert-butyl N-(4-bromo-6-chloro-3-pyridinyl)carbamate. InChIKey: QLHHSMBWVZSWGX-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O2 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-6-chloro-3-pyridinyl)carbamate |
| InChIKey | QLHHSMBWVZSWGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1Br)Cl |
Computed by PubChem (NCBI)