Products 1622407-11-7
CAS 1622407-11-7 appears in our catalog under these names: tert-butyl (3-bromo-2-chloropyridin-4-yl)carbamate, 98%, 98%, (3-Bromo-2-chloro-pyridin-4-yl)-carbamic acid tert-butyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
Tert-butyl N-(3-bromo-2-chloro-4-pyridinyl)carbamate (CAS 1622407-11-7) is a chemical compound with the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. IUPAC name: tert-butyl N-(3-bromo-2-chloro-4-pyridinyl)carbamate. InChIKey: GYSNVXLARRFYON-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O2 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-2-chloro-4-pyridinyl)carbamate |
| InChIKey | GYSNVXLARRFYON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=NC=C1)Cl)Br |
Computed by PubChem (NCBI)