CAS 193888-15-2 is the registry number for 3-(BOC-Amino)-5-bromo-2-chloropyridine, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
Tert-butyl N-(5-bromo-2-chloro-3-pyridinyl)carbamate (CAS 193888-15-2) is a chemical compound with the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-chloro-3-pyridinyl)carbamate. InChIKey: WHXZDMLRCAXMNG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O2 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-chloro-3-pyridinyl)carbamate |
| InChIKey | WHXZDMLRCAXMNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)