CAS 2096334-39-1 is the registry number for 4-Chloro-2-(aminomethyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 2096334-39-1) is a chemical compound with the molecular formula C13H19BClNO2 and a molecular weight of 267.56 g/mol. IUPAC name: [5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: OIOPKOIZMBWBRC-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO2 |
|---|---|
| Molecular weight | 267.56 g/mol |
| IUPAC name | [5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | OIOPKOIZMBWBRC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)CN |
Computed by PubChem (NCBI)