CAS 2121513-87-7 is the registry number for 2-Amino-3-chloro-5-methylphenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2121513-87-7) is a chemical compound with the molecular formula C13H19BClNO2 and a molecular weight of 267.56 g/mol. IUPAC name: 2-chloro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: YDKMGNQLTMYBJH-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO2 |
|---|---|
| Molecular weight | 267.56 g/mol |
| IUPAC name | 2-chloro-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | YDKMGNQLTMYBJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2N)Cl)C |
Computed by PubChem (NCBI)