CAS 2377608-30-3 is the registry number for 5-Chloro-4-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-chloro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2377608-30-3) is a chemical compound with the molecular formula C13H19BClNO2 and a molecular weight of 267.56 g/mol. IUPAC name: 5-chloro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: BEUOIFAPGOYXNV-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO2 |
|---|---|
| Molecular weight | 267.56 g/mol |
| IUPAC name | 5-chloro-4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | BEUOIFAPGOYXNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2N)Cl)C |
Computed by PubChem (NCBI)