Products 2096334-90-4
CAS 2096334-90-4 is the registry number for (5-(Ethyl(methyl)amino)pyridin-3-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-[ethyl(methyl)amino]-3-pyridinyl]boronic acid (CAS 2096334-90-4) is a chemical compound with the molecular formula C8H13BN2O2 and a molecular weight of 180.01 g/mol. IUPAC name: [5-[ethyl(methyl)amino]-3-pyridinyl]boronic acid. InChIKey: DJMOXNKFPKSVNZ-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O2 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | [5-[ethyl(methyl)amino]-3-pyridinyl]boronic acid |
| InChIKey | DJMOXNKFPKSVNZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)N(C)CC)(O)O |
Computed by PubChem (NCBI)