CAS 2225172-69-8 is the registry number for 3–Methyl–1–(cyclobutyl)pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(1-cyclobutyl-3-methylpyrazol-4-yl)boronic acid (CAS 2225172-69-8) is a chemical compound with the molecular formula C8H13BN2O2 and a molecular weight of 180.01 g/mol. IUPAC name: (1-cyclobutyl-3-methylpyrazol-4-yl)boronic acid. InChIKey: RGPRZHGRHPKUON-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O2 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (1-cyclobutyl-3-methylpyrazol-4-yl)boronic acid |
| InChIKey | RGPRZHGRHPKUON-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2CCC2)(O)O |
Computed by PubChem (NCBI)