CAS 2225177-33-1 is the registry number for (5–(2–aminopropan–2–yl)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-(2-aminopropan-2-yl)-3-pyridinyl]boronic acid (CAS 2225177-33-1) is a chemical compound with the molecular formula C8H13BN2O2 and a molecular weight of 180.01 g/mol. IUPAC name: [5-(2-aminopropan-2-yl)-3-pyridinyl]boronic acid. InChIKey: VQBRBYYEKQMKQG-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O2 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | [5-(2-aminopropan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | VQBRBYYEKQMKQG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C(C)(C)N)(O)O |
Computed by PubChem (NCBI)