Products 2096337-28-7
CAS 2096337-28-7 is the registry number for N-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isonicotinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carboxamide (CAS 2096337-28-7) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carboxamide. InChIKey: GLYQLWRHKIRXIL-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carboxamide |
| InChIKey | GLYQLWRHKIRXIL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)C(=O)NC |
Computed by PubChem (NCBI)