CAS 2096419-45-1 is the registry number for (5R)-5H,6H,7H-Cyclopenta[c]pyridine-1,5-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(5R)-6,7-dihydro-5H-cyclopenta[c]pyridine-1,5-diamine;dihydrochloride (CAS 2096419-45-1) is a chemical compound with the molecular formula C8H13Cl2N3 and a molecular weight of 222.11 g/mol. IUPAC name: (5R)-6,7-dihydro-5H-cyclopenta[c]pyridine-1,5-diamine;dihydrochloride. InChIKey: WBRPPQHUNQRULX-XCUBXKJBSA-N.
| Molecular formula | C8H13Cl2N3 |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | (5R)-6,7-dihydro-5H-cyclopenta[c]pyridine-1,5-diamine;dihydrochloride |
| InChIKey | WBRPPQHUNQRULX-XCUBXKJBSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CN=C2N.Cl.Cl |
Computed by PubChem (NCBI)