CAS 3023063-29-5 appears in our catalog under these names: 3-(1H-pyrazol-4-yl)bicyclo[1.1.1]pentan-1-amine dihydrochloride, 95%, 3-(1H-pyrazol-4-yl)bicyclo[1.1.1]pentan-1-amine dihydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
3-(1H-pyrazol-4-yl)bicyclo[1.1.1]pentan-1-amine;dihydrochloride (CAS 3023063-29-5) is a chemical compound with the molecular formula C8H13Cl2N3 and a molecular weight of 222.11 g/mol. IUPAC name: 3-(1H-pyrazol-4-yl)bicyclo[1.1.1]pentan-1-amine;dihydrochloride. InChIKey: RCGSCMVZHFJQHV-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3 |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 3-(1H-pyrazol-4-yl)bicyclo[1.1.1]pentan-1-amine;dihydrochloride |
| InChIKey | RCGSCMVZHFJQHV-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C3=CNN=C3.Cl.Cl |
Computed by PubChem (NCBI)