CAS 217313-79-6 appears in our catalog under these names: 4-Aminomethyl Benzamidine Dihydrochloride, 4-Aminomethyl benzamidine dihydrochloride, 96%. Offered by: TRC, Fluorochem. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 1g, 5g.
4-(aminomethyl)benzenecarboximidamide;dihydrochloride (CAS 217313-79-6) is a chemical compound with the molecular formula C8H13Cl2N3 and a molecular weight of 222.11 g/mol. IUPAC name: 4-(aminomethyl)benzenecarboximidamide;dihydrochloride. InChIKey: VZQHJODNUJKHBM-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3 |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 4-(aminomethyl)benzenecarboximidamide;dihydrochloride |
| InChIKey | VZQHJODNUJKHBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)