Products 209680-92-2
CAS 209680-92-2 is the registry number for Boc-D-Phg(3-CF3)-OH, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 5g, 1g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid (CAS 209680-92-2) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid. InChIKey: NVMKZXKHKQKKFE-SNVBAGLBSA-N.
| Molecular formula | C14H16F3NO4 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | NVMKZXKHKQKKFE-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC(=CC=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)