Products 2097141-18-7
CAS 2097141-18-7 appears in our catalog under these names: (S)–3'–amino Blebbistatin, (3αS)-1-(3-Aminophenyl)-3α-hydroxy-6-methyl-2,3-dihydropyrrolo(2,3-β)quinolin-4-one, (S)-3'-Aminoblebbistatin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(3aS)-1-(3-aminophenyl)-3a-hydroxy-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one (CAS 2097141-18-7) is a chemical compound with the molecular formula C18H17N3O2 and a molecular weight of 307.3 g/mol. IUPAC name: (3aS)-1-(3-aminophenyl)-3a-hydroxy-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one. InChIKey: WWBDMJMBRYIBAY-GOSISDBHSA-N.
| Molecular formula | C18H17N3O2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | (3aS)-1-(3-aminophenyl)-3a-hydroxy-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one |
| InChIKey | WWBDMJMBRYIBAY-GOSISDBHSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C3[C@](C2=O)(CCN3C4=CC=CC(=C4)N)O |
Computed by PubChem (NCBI)