CAS 2097881-89-3 appears in our catalog under these names: (E)-3-(2-Methylpyridin-4-yl)acrylic acid, 98%, (E)-3-(2-Methylpyridin-4-yl)acrylic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
(E)-3-(2-methyl-4-pyridinyl)prop-2-enoic acid (CAS 2097881-89-3) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-3-(2-methyl-4-pyridinyl)prop-2-enoic acid. InChIKey: RHRYWOAASMAMDC-NSCUHMNNSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (E)-3-(2-methyl-4-pyridinyl)prop-2-enoic acid |
| InChIKey | RHRYWOAASMAMDC-NSCUHMNNSA-N |
| SMILES | CC1=NC=CC(=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)