CAS 2097938-70-8 is the registry number for 3-Bromo-5-chloro-6-methylpyrazolo[1,5-a]pyrimidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-chloro-6-methylpyrazolo[1,5-a]pyrimidine (CAS 2097938-70-8) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 3-bromo-5-chloro-6-methylpyrazolo[1,5-a]pyrimidine. InChIKey: SHWJAFILFOZHGC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 3-bromo-5-chloro-6-methylpyrazolo[1,5-a]pyrimidine |
| InChIKey | SHWJAFILFOZHGC-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(C=N2)Br)N=C1Cl |
Computed by PubChem (NCBI)