Products 2097948-93-9
CAS 2097948-93-9 is the registry number for 2-Amino-1-(7-chloro-2,3-dihydrobenzo(f)(1,4)oxazepin-4(5H)-yl)propan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
2-amino-1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-one (CAS 2097948-93-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-amino-1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-one. InChIKey: JDJLLGDJOUPDGO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-amino-1-(7-chloro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-one |
| InChIKey | JDJLLGDJOUPDGO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCOC2=C(C1)C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)