Products 209797-79-5
CAS 209797-79-5 is the registry number for 6-o-(E)-Caffeoylglucopyranose. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 209797-79-5) is a chemical compound with the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. IUPAC name: (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: JVVFTHAOTNXPOZ-UHFFFAOYSA-N.
| Molecular formula | C15H18O9 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | JVVFTHAOTNXPOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)O)O)O)O)O)O |
Computed by PubChem (NCBI)