CAS 935658-91-6 appears in our catalog under these names: 6–Alkynyl fucose, 6-Alkynyl fucose, 98.0%, 6-Alkynyl-L-fucose tetraacetate, (3S,4R,5R,6S)-6-Ethynyltetrahydro-2H-pyran-2,3,4,5-tetrayl Tetraacetate, 1,2,3,4-Tetra-O-acetyl-5-alkynyl-L-fucose. Offered by: GLPBio, MedChemExpress, Biosynth, TRC, Roth. Available pack sizes: 1mg, 100 mg, 50 mg, 5 mg, 10 mg, 25 mg, 0,5mg, 25mg.
[(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate (CAS 935658-91-6) is a chemical compound with the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. IUPAC name: [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate. InChIKey: FVDSJNFPNWVBGX-GVLTWOEFSA-N.
| Molecular formula | C15H18O9 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate |
| InChIKey | FVDSJNFPNWVBGX-GVLTWOEFSA-N |
| SMILES | CC(=O)O[C@H]1[C@H](OC([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)C#C |
Computed by PubChem (NCBI)