CAS 2563871-46-3 is the registry number for (2S,3S,4R,5S,6S)-2-Ethynyl-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxane-2-carboxylate (CAS 2563871-46-3) is a chemical compound with the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. IUPAC name: methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxane-2-carboxylate. InChIKey: DZIBXFZMXLGEKN-HPCHECBXSA-N.
| Molecular formula | C15H18O9 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxane-2-carboxylate |
| InChIKey | DZIBXFZMXLGEKN-HPCHECBXSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](O[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)C(=O)OC)C#C |
Computed by PubChem (NCBI)