CAS 210217-79-1 is the registry number for (3R,4S,5S,6R)-6-Ethynyltetrahydro-2H-pyran-2,3,4,5-tetrayl Tetraacetate. Offered by: TRC. Available pack sizes: 100mg.
[(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate (CAS 210217-79-1) is a chemical compound with the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. IUPAC name: [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate. InChIKey: FVDSJNFPNWVBGX-GVLTWOEFSA-N.
| Molecular formula | C15H18O9 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-ethynyloxan-3-yl] acetate |
| InChIKey | FVDSJNFPNWVBGX-GVLTWOEFSA-N |
| SMILES | CC(=O)O[C@H]1[C@H](OC([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)C#C |
Computed by PubChem (NCBI)