CAS 2098069-47-5 is the registry number for 2',2'-Difluoro-3'-methyl-8-azaspiro[bicyclo[3.2.1]octane-3,1'-cyclopropane], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1',1'-difluoro-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane] (CAS 2098069-47-5) is a chemical compound with the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. IUPAC name: 1',1'-difluoro-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]. InChIKey: FITAOGUKNBORSS-UHFFFAOYSA-N.
| Molecular formula | C10H15F2N |
|---|---|
| Molecular weight | 187.23 g/mol |
| IUPAC name | 1',1'-difluoro-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane] |
| InChIKey | FITAOGUKNBORSS-UHFFFAOYSA-N |
| SMILES | CC1C2(C1(F)F)CC3CCC(C2)N3 |
Computed by PubChem (NCBI)