CAS 2098076-74-3 is the registry number for 11,11-Difluoro-8-azadispiro[3.0.55.14]undecane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
11,11-difluoro-8-azadispiro[3.0.55.14]undecane (CAS 2098076-74-3) is a chemical compound with the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. IUPAC name: 11,11-difluoro-8-azadispiro[3.0.55.14]undecane. InChIKey: DTSDCWLJIVKKOK-UHFFFAOYSA-N.
| Molecular formula | C10H15F2N |
|---|---|
| Molecular weight | 187.23 g/mol |
| IUPAC name | 11,11-difluoro-8-azadispiro[3.0.55.14]undecane |
| InChIKey | DTSDCWLJIVKKOK-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C3(C2(F)F)CCNCC3 |
Computed by PubChem (NCBI)