CAS 214557-82-1 appears in our catalog under these names: 3,5-Difluoroadamantan-1-amine, 3,5-Difluoroadamantan-1-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3,5-difluoroadamantan-1-amine (CAS 214557-82-1) is a chemical compound with the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. IUPAC name: 3,5-difluoroadamantan-1-amine. InChIKey: SIZUPHQRAFPCNJ-UHFFFAOYSA-N.
| Molecular formula | C10H15F2N |
|---|---|
| Molecular weight | 187.23 g/mol |
| IUPAC name | 3,5-difluoroadamantan-1-amine |
| InChIKey | SIZUPHQRAFPCNJ-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1(CC(C2)(C3)F)N)F |
Computed by PubChem (NCBI)